C16H18N2O5S — CID 90594704
3-(furan-2-ylmethylsulfonyl)-N-(4-methoxyphenyl)azetidine-1-carboxamide (PubChem CID 90594704) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfonyl)-N-(4-methoxyphenyl)azetidine-1-carboxamide.
| Compound Name | 3-(furan-2-ylmethylsulfonyl)-N-(4-methoxyphenyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 90594704 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-(furan-2-ylmethylsulfonyl)-N-(4-methoxyphenyl)azetidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CC(S(=O)(=O)Cc3ccco3)C2)cc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-22-13-6-4-12(5-7-13)17-16(19)18-9-15(10-18)24(20,21)11-14-3-2-8-23-14/h2-8,15H,9-11H2,1H3,(H,17,19) |
| InChIKey | OXFUUBHWYLZOLU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |