C21H21N3O3 — CID 90595310
N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 90595310) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90595310 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[4-(3-methoxypyrrolidin-1-yl)phenyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | COC1CCN(c2ccc(NC(=O)c3cc(-c4ccccc4)on3)cc2)C1 |
| InChI | InChI=1S/C21H21N3O3/c1-26-18-11-12-24(14-18)17-9-7-16(8-10-17)22-21(25)19-13-20(27-23-19)15-5-3-2-4-6-15/h2-10,13,18H,11-12,14H2,1H3,(H,22,25) |
| InChIKey | CWGPBKNFKGBRPQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|