C16H20N2O3S — CID 90596373
N-[(3-pyridin-2-yloxyphenyl)methyl]butane-1-sulfonamide (PubChem CID 90596373) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[(3-pyridin-2-yloxyphenyl)methyl]butane-1-sulfonamide.
| Compound Name | N-[(3-pyridin-2-yloxyphenyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 90596373 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[(3-pyridin-2-yloxyphenyl)methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCc1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-2-3-11-22(19,20)18-13-14-7-6-8-15(12-14)21-16-9-4-5-10-17-16/h4-10,12,18H,2-3,11,13H2,1H3 |
| InChIKey | OAEYXVYXXZXSLM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |