C16H17N5O3 — CID 90597597
5-(furan-2-yl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide (PubChem CID 90597597) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90597597 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-(furan-2-yl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cnn(C2CCOCC2)c1)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C16H17N5O3/c22-16(14-8-13(19-20-14)15-2-1-5-24-15)18-11-9-17-21(10-11)12-3-6-23-7-4-12/h1-2,5,8-10,12H,3-4,6-7H2,(H,18,22)(H,19,20) |
| InChIKey | JVPBEGOQNRYFPI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |