C19H21ClN4O3 — CID 90597712
1-(4-chlorophenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 90597712) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90597712 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cnn(C2CCOCC2)c1)C1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H21ClN4O3/c20-14-1-3-16(4-2-14)23-11-13(9-18(23)25)19(26)22-15-10-21-24(12-15)17-5-7-27-8-6-17/h1-4,10,12-13,17H,5-9,11H2,(H,22,26) |
| InChIKey | BMNPLPYNVAJODV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |