C18H17F4NO2 — CID 90599146
N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-(trifluoromethyl)benzamide (PubChem CID 90599146) has the molecular formula C18H17F4NO2 and a molecular weight of 355.33 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90599146 |
| Molecular Formula | C18H17F4NO2 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-(trifluoromethyl)benzamide |
| SMILES | COC(C)(CNC(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1F |
| InChI | InChI=1S/C18H17F4NO2/c1-17(25-2,14-5-3-4-6-15(14)19)11-23-16(24)12-7-9-13(10-8-12)18(20,21)22/h3-10H,11H2,1-2H3,(H,23,24) |
| InChIKey | SUHGWDDQPUPQEA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |