C19H28ClNO2 — CID 90599865
N-[2-(3-chlorophenyl)-2-methoxypropyl]-3-cyclohexylpropanamide (PubChem CID 90599865) has the molecular formula C19H28ClNO2 and a molecular weight of 337.89 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-methoxypropyl]-3-cyclohexylpropanamide.
| Compound Name | N-[2-(3-chlorophenyl)-2-methoxypropyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 90599865 |
| Molecular Formula | C19H28ClNO2 |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-methoxypropyl]-3-cyclohexylpropanamide |
| SMILES | COC(C)(CNC(=O)CCC1CCCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H28ClNO2/c1-19(23-2,16-9-6-10-17(20)13-16)14-21-18(22)12-11-15-7-4-3-5-8-15/h6,9-10,13,15H,3-5,7-8,11-12,14H2,1-2H3,(H,21,22) |
| InChIKey | YNQLPFROFIODDV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |