C11H15BrClNO3S — CID 90600008
1-bromo-N-[2-(3-chlorophenyl)-2-methoxypropyl]methanesulfonamide (PubChem CID 90600008) has the molecular formula C11H15BrClNO3S and a molecular weight of 356.67 g/mol. Its IUPAC name is 1-bromo-N-[2-(3-chlorophenyl)-2-methoxypropyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[2-(3-chlorophenyl)-2-methoxypropyl]methanesulfonamide |
|---|---|
| PubChem CID | 90600008 |
| Molecular Formula | C11H15BrClNO3S |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 1-bromo-N-[2-(3-chlorophenyl)-2-methoxypropyl]methanesulfonamide |
| SMILES | COC(C)(CNS(=O)(=O)CBr)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15BrClNO3S/c1-11(17-2,7-14-18(15,16)8-12)9-4-3-5-10(13)6-9/h3-6,14H,7-8H2,1-2H3 |
| InChIKey | HUJGBDCCNXPRGX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|