C18H30N2O2S — CID 90603359
1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]-2-propylpentan-1-one (PubChem CID 90603359) has the molecular formula C18H30N2O2S and a molecular weight of 338.52 g/mol. Its IUPAC name is 1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]-2-propylpentan-1-one.
| Compound Name | 1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]-2-propylpentan-1-one |
|---|---|
| PubChem CID | 90603359 |
| Molecular Formula | C18H30N2O2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]-2-propylpentan-1-one |
| SMILES | CCCC(CCC)C(=O)N1CCN(CC(O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H30N2O2S/c1-3-6-15(7-4-2)18(22)20-11-9-19(10-12-20)14-16(21)17-8-5-13-23-17/h5,8,13,15-16,21H,3-4,6-7,9-12,14H2,1-2H3 |
| InChIKey | WBNWURLEGJULFB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |