C22H21ClN4O3S — CID 90603905
4-(4-chlorophenyl)sulfanyl-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-oxadiazol-2-yl]butanamide (PubChem CID 90603905) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-oxadiazol-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-oxadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 90603905 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[5-(5-oxo-1-phenylpyrrolidin-3-yl)-1,3,4-oxadiazol-2-yl]butanamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)Nc1nnc(C2CC(=O)N(c3ccccc3)C2)o1 |
| InChI | InChI=1S/C22H21ClN4O3S/c23-16-8-10-18(11-9-16)31-12-4-7-19(28)24-22-26-25-21(30-22)15-13-20(29)27(14-15)17-5-2-1-3-6-17/h1-3,5-6,8-11,15H,4,7,12-14H2,(H,24,26,28) |
| InChIKey | FSPMREPMETWECI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|