C23H19N3O2S — CID 90604085
1-(1,3-benzothiazol-2-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide (PubChem CID 90604085) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90604085 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)C1CN(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C23H19N3O2S/c27-22(16-14-26(15-16)23-25-19-11-5-7-13-21(19)29-23)24-18-10-4-6-12-20(18)28-17-8-2-1-3-9-17/h1-13,16H,14-15H2,(H,24,27) |
| InChIKey | MVYZTFOWDPNSAB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |