C16H26N4O3 — CID 90607429
N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-2-pyrazol-1-ylacetamide (PubChem CID 90607429) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-2-pyrazol-1-ylacetamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 90607429 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-2-pyrazol-1-ylacetamide |
| SMILES | O=C(Cn1cccn1)N(CCN1CCOCC1)C1CCOCC1 |
| InChI | InChI=1S/C16H26N4O3/c21-16(14-19-5-1-4-17-19)20(15-2-10-22-11-3-15)7-6-18-8-12-23-13-9-18/h1,4-5,15H,2-3,6-14H2 |
| InChIKey | DUUBUOLZTSMXSI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |