C19H28ClN3O3 — CID 90607460
3-[(4-chlorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-1-(oxan-4-yl)urea (PubChem CID 90607460) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-1-(oxan-4-yl)urea.
| Compound Name | 3-[(4-chlorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-1-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 90607460 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-1-(oxan-4-yl)urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)N(CCN1CCOCC1)C1CCOCC1 |
| InChI | InChI=1S/C19H28ClN3O3/c20-17-3-1-16(2-4-17)15-21-19(24)23(18-5-11-25-12-6-18)8-7-22-9-13-26-14-10-22/h1-4,18H,5-15H2,(H,21,24) |
| InChIKey | XYZGVIRVOJTLEM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |