C19H18FN3OS — CID 90609526
1-(4-fluoro-1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide (PubChem CID 90609526) has the molecular formula C19H18FN3OS and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-(4-fluoro-1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-(4-fluoro-1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 90609526 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-(4-fluoro-1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(c2nc3c(F)cccc3s2)CC1 |
| InChI | InChI=1S/C19H18FN3OS/c20-15-7-4-8-16-17(15)22-19(25-16)23-11-9-13(10-12-23)18(24)21-14-5-2-1-3-6-14/h1-8,13H,9-12H2,(H,21,24) |
| InChIKey | VTSCZZPESGWTJI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |