C22H26N4O2S — CID 90611514
N-[4-(dimethylamino)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-4-carboxamide (PubChem CID 90611514) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90611514 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
| SMILES | COc1ccc2nc(N3CCC(C(=O)Nc4ccc(N(C)C)cc4)CC3)sc2c1 |
| InChI | InChI=1S/C22H26N4O2S/c1-25(2)17-6-4-16(5-7-17)23-21(27)15-10-12-26(13-11-15)22-24-19-9-8-18(28-3)14-20(19)29-22/h4-9,14-15H,10-13H2,1-3H3,(H,23,27) |
| InChIKey | OQHGEWSDELFXEN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|