C19H22N2O5S — CID 9061287
(3-methylphenyl)methyl 2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetate (PubChem CID 9061287) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is (3-methylphenyl)methyl 2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetate.
| Compound Name | (3-methylphenyl)methyl 2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 9061287 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (3-methylphenyl)methyl 2-[[2-[(4-methylphenyl)sulfonylamino]acetyl]amino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)NCC(=O)OCc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-14-6-8-17(9-7-14)27(24,25)21-11-18(22)20-12-19(23)26-13-16-5-3-4-15(2)10-16/h3-10,21H,11-13H2,1-2H3,(H,20,22) |
| InChIKey | VAZMYAOXBMELFW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |