C21H27NO6 — CID 90613391
N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-3,4-diethoxybenzamide (PubChem CID 90613391) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 90613391 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(O)c2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H27NO6/c1-5-27-18-10-8-15(12-20(18)28-6-2)21(24)22-13-16(23)14-7-9-17(25-3)19(11-14)26-4/h7-12,16,23H,5-6,13H2,1-4H3,(H,22,24) |
| InChIKey | YBDJVHNQQULNMF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |