C15H19BrN4O2S — CID 90614605
1-bromo-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]methanesulfonamide (PubChem CID 90614605) has the molecular formula C15H19BrN4O2S and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-bromo-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 90614605 |
| Molecular Formula | C15H19BrN4O2S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 1-bromo-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)NCCn1nc(-c2ccccn2)c2c1CCCC2 |
| InChI | InChI=1S/C15H19BrN4O2S/c16-11-23(21,22)18-9-10-20-14-7-2-1-5-12(14)15(19-20)13-6-3-4-8-17-13/h3-4,6,8,18H,1-2,5,7,9-11H2 |
| InChIKey | XPWKAYLFBUVOQG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|