C12H14O3 — CID 906160
3,7,7-trimethyl-6,8-dihydrochromene-4,5-dione (PubChem CID 906160) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3,7,7-trimethyl-6,8-dihydrochromene-4,5-dione.
| Compound Name | 3,7,7-trimethyl-6,8-dihydrochromene-4,5-dione |
|---|---|
| PubChem CID | 906160 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3,7,7-trimethyl-6,8-dihydrochromene-4,5-dione |
| SMILES | Cc1coc2c(c1=O)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C12H14O3/c1-7-6-15-9-5-12(2,3)4-8(13)10(9)11(7)14/h6H,4-5H2,1-3H3 |
| InChIKey | WKZUCWKHKJHMGO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |