C15H20N2O2S — CID 90616057
1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-2-pyridin-3-yloxyethanone (PubChem CID 90616057) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-2-pyridin-3-yloxyethanone.
| Compound Name | 1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-2-pyridin-3-yloxyethanone |
|---|---|
| PubChem CID | 90616057 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-2-pyridin-3-yloxyethanone |
| SMILES | CSC1CC2CCC(C1)N2C(=O)COc1cccnc1 |
| InChI | InChI=1S/C15H20N2O2S/c1-20-14-7-11-4-5-12(8-14)17(11)15(18)10-19-13-3-2-6-16-9-13/h2-3,6,9,11-12,14H,4-5,7-8,10H2,1H3 |
| InChIKey | ABKBKJGTKPKCHU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |