C11H14F5NOS — CID 90616093
2,2,3,3,3-pentafluoro-1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)propan-1-one (PubChem CID 90616093) has the molecular formula C11H14F5NOS and a molecular weight of 303.30 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)propan-1-one |
|---|---|
| PubChem CID | 90616093 |
| Molecular Formula | C11H14F5NOS |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)propan-1-one |
| SMILES | CSC1CC2CCC(C1)N2C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F5NOS/c1-19-8-4-6-2-3-7(5-8)17(6)9(18)10(12,13)11(14,15)16/h6-8H,2-5H2,1H3 |
| InChIKey | ITMXCLUOLOJVBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|