C21H31N3O4 — CID 90616430
3-methoxy-N-[2-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 90616430) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-methoxy-N-[2-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 90616430 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 3-methoxy-N-[2-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCC(=O)N2CCC(N3CCC(OC)CC3)CC2)c1 |
| InChI | InChI=1S/C21H31N3O4/c1-27-18-8-12-23(13-9-18)17-6-10-24(11-7-17)20(25)15-22-21(26)16-4-3-5-19(14-16)28-2/h3-5,14,17-18H,6-13,15H2,1-2H3,(H,22,26) |
| InChIKey | ALORHSJHIKDSEZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |