C20H24IN3O2S — CID 90617849
(4-iodophenyl)-[4-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]piperidin-1-yl]methanone (PubChem CID 90617849) has the molecular formula C20H24IN3O2S and a molecular weight of 497.40 g/mol. Its IUPAC name is (4-iodophenyl)-[4-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]piperidin-1-yl]methanone.
| Compound Name | (4-iodophenyl)-[4-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90617849 |
| Molecular Formula | C20H24IN3O2S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | (4-iodophenyl)-[4-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(I)cc1)N1CCC(N2CCC(Oc3nccs3)CC2)CC1 |
| InChI | InChI=1S/C20H24IN3O2S/c21-16-3-1-15(2-4-16)19(25)24-10-5-17(6-11-24)23-12-7-18(8-13-23)26-20-22-9-14-27-20/h1-4,9,14,17-18H,5-8,10-13H2 |
| InChIKey | GTISWLREZCXNPK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|