C14H10N2O6 — CID 906182
ethyl 8-nitro-7-oxo-3H-pyrano[3,2-e]indole-2-carboxylate (PubChem CID 906182) has the molecular formula C14H10N2O6 and a molecular weight of 302.24 g/mol. Its IUPAC name is ethyl 8-nitro-7-oxo-3H-pyrano[3,2-e]indole-2-carboxylate.
| Compound Name | ethyl 8-nitro-7-oxo-3H-pyrano[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 906182 |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | ethyl 8-nitro-7-oxo-3H-pyrano[3,2-e]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccc3oc(=O)c([N+](=O)[O-])cc32)[nH]1 |
| InChI | InChI=1S/C14H10N2O6/c1-2-21-13(17)10-5-7-8-6-11(16(19)20)14(18)22-12(8)4-3-9(7)15-10/h3-6,15H,2H2,1H3 |
| InChIKey | SXXNEOARUAKMCD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|