About 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one
1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 90618400) has the molecular formula C19H17F2NO4S
and a molecular weight of 393.41 g/mol. Its IUPAC name is 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one.
Molecular Properties
| Compound Name | 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
| PubChem CID | 90618400 |
| Molecular Formula | C19H17F2NO4S |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | O=C1OC2(CCN(S(=O)(=O)Cc3cc(F)ccc3F)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H17F2NO4S/c20-14-5-6-17(21)13(11-14)12-27(24,25)22-9-7-19(8-10-22)16-4-2-1-3-15(16)18(23)26-19/h1-6,11H,7-10,12H2 |
| InChIKey | BVSUFWPDAADECL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one?
The IUPAC name of 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one (CID 90618400) is 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one.
What is the SMILES notation for 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one?
The canonical SMILES for 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one is O=C1OC2(CCN(S(=O)(=O)Cc3cc(F)ccc3F)CC2)c2ccccc21.
What is the InChIKey of 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one?
The InChIKey is BVSUFWPDAADECL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2NO4S/c20-14-5-6-17(21)13(11-14)12-27(24,25)22-9-7-19(8-10-22)16-4-2-1-3-15(16)18(23)26-19/h1-6,11H,7-10,12H2.
What are the key properties of 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one?
1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one has a molecular weight of 393.41 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[(2,5-difluorophenyl)methylsulfonyl]spiro[2-benzofuran-3,4'-piperidine]-1-one is sourced from PubChem (CID 90618400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).