About 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one
1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 90618560) has the molecular formula C21H19Cl2NO3
and a molecular weight of 404.29 g/mol. Its IUPAC name is 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one.
Molecular Properties
| Compound Name | 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one |
| PubChem CID | 90618560 |
| Molecular Formula | C21H19Cl2NO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | O=C1OC2(CCCN(C(=O)CCc3c(Cl)cccc3Cl)C2)c2ccccc21 |
| InChI | InChI=1S/C21H19Cl2NO3/c22-17-7-3-8-18(23)15(17)9-10-19(25)24-12-4-11-21(13-24)16-6-2-1-5-14(16)20(26)27-21/h1-3,5-8H,4,9-13H2 |
| InChIKey | BUSFHYXFBOMGIF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one?
The IUPAC name of 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one (CID 90618560) is 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one.
What is the SMILES notation for 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one?
The canonical SMILES for 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one is O=C1OC2(CCCN(C(=O)CCc3c(Cl)cccc3Cl)C2)c2ccccc21.
What is the InChIKey of 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one?
The InChIKey is BUSFHYXFBOMGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2NO3/c22-17-7-3-8-18(23)15(17)9-10-19(25)24-12-4-11-21(13-24)16-6-2-1-5-14(16)20(26)27-21/h1-3,5-8H,4,9-13H2.
What are the key properties of 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one?
1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one has a molecular weight of 404.29 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[3-(2,6-dichlorophenyl)propanoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one is sourced from PubChem (CID 90618560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).