C17H21N3OS — CID 90621291
3-(3-methylthiophen-2-yl)-N-(1-pyridin-2-ylpyrrolidin-3-yl)propanamide (PubChem CID 90621291) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-(3-methylthiophen-2-yl)-N-(1-pyridin-2-ylpyrrolidin-3-yl)propanamide.
| Compound Name | 3-(3-methylthiophen-2-yl)-N-(1-pyridin-2-ylpyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 90621291 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-(3-methylthiophen-2-yl)-N-(1-pyridin-2-ylpyrrolidin-3-yl)propanamide |
| SMILES | Cc1ccsc1CCC(=O)NC1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C17H21N3OS/c1-13-8-11-22-15(13)5-6-17(21)19-14-7-10-20(12-14)16-4-2-3-9-18-16/h2-4,8-9,11,14H,5-7,10,12H2,1H3,(H,19,21) |
| InChIKey | ZRFNGJMLXYHYAQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |