C16H18ClN3O3 — CID 90622542
4-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]butanamide (PubChem CID 90622542) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 4-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]butanamide.
| Compound Name | 4-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 90622542 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]butanamide |
| SMILES | O=C(CCCCl)Nc1cnn(CC2COc3ccccc3O2)c1 |
| InChI | InChI=1S/C16H18ClN3O3/c17-7-3-6-16(21)19-12-8-18-20(9-12)10-13-11-22-14-4-1-2-5-15(14)23-13/h1-2,4-5,8-9,13H,3,6-7,10-11H2,(H,19,21) |
| InChIKey | DIRNRZXNPYZJTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|