About 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one
4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one (PubChem CID 906230) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one |
| PubChem CID | 906230 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one |
| SMILES | COc1ccc(CCNc2cc(C)[nH]c(=O)c2)cc1OC |
| InChI | InChI=1S/C16H20N2O3/c1-11-8-13(10-16(19)18-11)17-7-6-12-4-5-14(20-2)15(9-12)21-3/h4-5,8-10H,6-7H2,1-3H3,(H2,17,18,19) |
| InChIKey | SFZGIEQYHCWVLL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one?
The IUPAC name of 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one (CID 906230) is 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one.
What is the SMILES notation for 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one?
The canonical SMILES for 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one is COc1ccc(CCNc2cc(C)[nH]c(=O)c2)cc1OC.
What is the InChIKey of 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one?
The InChIKey is SFZGIEQYHCWVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-11-8-13(10-16(19)18-11)17-7-6-12-4-5-14(20-2)15(9-12)21-3/h4-5,8-10H,6-7H2,1-3H3,(H2,17,18,19).
What are the key properties of 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one?
4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one has a molecular weight of 288.35 g/mol, XLogP of 2.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-dimethoxyphenyl)ethylamino]-6-methyl-1H-pyridin-2-one is sourced from PubChem (CID 906230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).