C14H19N3O4S — CID 90623533
N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 90623533) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 90623533 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[2-methoxy-2-(3-methoxyphenyl)ethyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | COc1cccc(C(CNS(=O)(=O)c2cnn(C)c2)OC)c1 |
| InChI | InChI=1S/C14H19N3O4S/c1-17-10-13(8-15-17)22(18,19)16-9-14(21-3)11-5-4-6-12(7-11)20-2/h4-8,10,14,16H,9H2,1-3H3 |
| InChIKey | FHGYDABDPYNYMO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |