C18H19F3N2O3 — CID 90623654
1-[2-methoxy-2-(3-methoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 90623654) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-[2-methoxy-2-(3-methoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-methoxy-2-(3-methoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90623654 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[2-methoxy-2-(3-methoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cccc(C(CNC(=O)Nc2cccc(C(F)(F)F)c2)OC)c1 |
| InChI | InChI=1S/C18H19F3N2O3/c1-25-15-8-3-5-12(9-15)16(26-2)11-22-17(24)23-14-7-4-6-13(10-14)18(19,20)21/h3-10,16H,11H2,1-2H3,(H2,22,23,24) |
| InChIKey | QWZDJKSXHOHKAQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |