C16H19NO6 — CID 9062402
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 9062402) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 9062402 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1cc(OC)c2c(c1)OCCO2 |
| InChI | InChI=1S/C16H19NO6/c1-4-5-17-15(18)10(2)23-16(19)11-8-12(20-3)14-13(9-11)21-6-7-22-14/h4,8-10H,1,5-7H2,2-3H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | PJTRJTZYHPUFRB-JTQLQIEISA-N |
| XLogP | 1.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|