C16H23F3N2O3 — CID 90624347
N-[(2-methoxy-2-adamantyl)methyl]-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 90624347) has the molecular formula C16H23F3N2O3 and a molecular weight of 348.37 g/mol. Its IUPAC name is N-[(2-methoxy-2-adamantyl)methyl]-N'-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N-[(2-methoxy-2-adamantyl)methyl]-N'-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 90624347 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[(2-methoxy-2-adamantyl)methyl]-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | COC1(CNC(=O)C(=O)NCC(F)(F)F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H23F3N2O3/c1-24-15(7-20-13(22)14(23)21-8-16(17,18)19)11-3-9-2-10(5-11)6-12(15)4-9/h9-12H,2-8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | GVNATPMLBPVFAR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|