C20H26N2O4 — CID 9062563
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 1-benzyl-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 9062563) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 1-benzyl-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 1-benzyl-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9062563 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 1-benzyl-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)c1cc(C)n(Cc2ccccc2)c1C |
| InChI | InChI=1S/C20H26N2O4/c1-14-12-18(15(2)22(14)13-17-8-6-5-7-9-17)20(24)26-16(3)19(23)21-10-11-25-4/h5-9,12,16H,10-11,13H2,1-4H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | PDTRTXYEIKEZFK-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|