About N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide
N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 90625995) has the molecular formula C20H14F3N3OS
and a molecular weight of 401.41 g/mol. Its IUPAC name is N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 90625995 |
| Molecular Formula | C20H14F3N3OS |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)Nc1ccccc1-c1cn2ccsc2n1 |
| InChI | InChI=1S/C20H14F3N3OS/c21-20(22,23)14-7-5-13(6-8-14)11-18(27)24-16-4-2-1-3-15(16)17-12-26-9-10-28-19(26)25-17/h1-10,12H,11H2,(H,24,27) |
| InChIKey | NFTRUOKHNNCGAW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide (CID 90625995) is N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide is O=C(Cc1ccc(C(F)(F)F)cc1)Nc1ccccc1-c1cn2ccsc2n1.
What is the InChIKey of N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide?
The InChIKey is NFTRUOKHNNCGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N3OS/c21-20(22,23)14-7-5-13(6-8-14)11-18(27)24-16-4-2-1-3-15(16)17-12-26-9-10-28-19(26)25-17/h1-10,12H,11H2,(H,24,27).
What are the key properties of N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide?
N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide has a molecular weight of 401.41 g/mol, XLogP of 5.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 90625995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).