C12H16N2O3S — CID 90627344
4-(8-azabicyclo[3.2.1]oct-2-en-8-ylsulfonyl)-3,5-dimethyl-1,2-oxazole (PubChem CID 90627344) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-(8-azabicyclo[3.2.1]oct-2-en-8-ylsulfonyl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(8-azabicyclo[3.2.1]oct-2-en-8-ylsulfonyl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 90627344 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-(8-azabicyclo[3.2.1]oct-2-en-8-ylsulfonyl)-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1C2C=CCC1CC2 |
| InChI | InChI=1S/C12H16N2O3S/c1-8-12(9(2)17-13-8)18(15,16)14-10-4-3-5-11(14)7-6-10/h3-4,10-11H,5-7H2,1-2H3 |
| InChIKey | FGLFWLHFAHVWKT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|