C21H26N4O — CID 90628173
1-adamantyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone (PubChem CID 90628173) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-adamantyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone.
| Compound Name | 1-adamantyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone |
|---|---|
| PubChem CID | 90628173 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-adamantyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone |
| SMILES | Cc1cc2ncc3c(n2n1)CCN(C(=O)C12CC4CC(CC(C4)C1)C2)C3 |
| InChI | InChI=1S/C21H26N4O/c1-13-4-19-22-11-17-12-24(3-2-18(17)25(19)23-13)20(26)21-8-14-5-15(9-21)7-16(6-14)10-21/h4,11,14-16H,2-3,5-10,12H2,1H3 |
| InChIKey | YREMHQSQMMZSAW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |