C22H19ClN4O3S — CID 90628477
11-[4-(2-chlorophenoxy)phenyl]sulfonyl-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene (PubChem CID 90628477) has the molecular formula C22H19ClN4O3S and a molecular weight of 454.94 g/mol. Its IUPAC name is 11-[4-(2-chlorophenoxy)phenyl]sulfonyl-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene.
| Compound Name | 11-[4-(2-chlorophenoxy)phenyl]sulfonyl-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 90628477 |
| Molecular Formula | C22H19ClN4O3S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 11-[4-(2-chlorophenoxy)phenyl]sulfonyl-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
| SMILES | Cc1cc2ncc3c(n2n1)CCN(S(=O)(=O)c1ccc(Oc2ccccc2Cl)cc1)C3 |
| InChI | InChI=1S/C22H19ClN4O3S/c1-15-12-22-24-13-16-14-26(11-10-20(16)27(22)25-15)31(28,29)18-8-6-17(7-9-18)30-21-5-3-2-4-19(21)23/h2-9,12-13H,10-11,14H2,1H3 |
| InChIKey | VQOSLMUVUSIBJP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |