About 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one
4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one (PubChem CID 90628955) has the molecular formula C18H17F2NO4
and a molecular weight of 349.33 g/mol. Its IUPAC name is 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one.
Molecular Properties
| Compound Name | 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one |
| PubChem CID | 90628955 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one |
| SMILES | Cc1cc(OC2CCN(C(=O)c3ccc(F)c(F)c3)CC2)cc(=O)o1 |
| InChI | InChI=1S/C18H17F2NO4/c1-11-8-14(10-17(22)24-11)25-13-4-6-21(7-5-13)18(23)12-2-3-15(19)16(20)9-12/h2-3,8-10,13H,4-7H2,1H3 |
| InChIKey | AJJVUNIEDHFFKG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one?
The IUPAC name of 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one (CID 90628955) is 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one.
What is the SMILES notation for 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one?
The canonical SMILES for 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one is Cc1cc(OC2CCN(C(=O)c3ccc(F)c(F)c3)CC2)cc(=O)o1.
What is the InChIKey of 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one?
The InChIKey is AJJVUNIEDHFFKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2NO4/c1-11-8-14(10-17(22)24-11)25-13-4-6-21(7-5-13)18(23)12-2-3-15(19)16(20)9-12/h2-3,8-10,13H,4-7H2,1H3.
What are the key properties of 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one?
4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one has a molecular weight of 349.33 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-difluorobenzoyl)piperidin-4-yl]oxy-6-methylpyran-2-one is sourced from PubChem (CID 90628955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).