C14H14F2N2O3S2 — CID 9062976
(2S)-2-(2,5-difluorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide (PubChem CID 9062976) has the molecular formula C14H14F2N2O3S2 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2S)-2-(2,5-difluorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide.
| Compound Name | (2S)-2-(2,5-difluorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 9062976 |
| Molecular Formula | C14H14F2N2O3S2 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | (2S)-2-(2,5-difluorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]propanamide |
| SMILES | C[C@H](Sc1cc(F)ccc1F)C(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C14H14F2N2O3S2/c1-8(23-11-6-9(15)2-3-10(11)16)13(20)17-4-5-18-12(19)7-22-14(18)21/h2-3,6,8H,4-5,7H2,1H3,(H,17,20)/t8-/m0/s1 |
| InChIKey | LIBHTMDBEXLIIL-QMMMGPOBSA-N |
| XLogP | 2.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|