About 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone
1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 90630778) has the molecular formula C20H20FNO3S
and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone.
Molecular Properties
| Compound Name | 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone |
| PubChem CID | 90630778 |
| Molecular Formula | C20H20FNO3S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CCSC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H20FNO3S/c21-16-4-2-1-3-14(16)12-20(23)22-8-7-19(26-10-9-22)15-5-6-17-18(11-15)25-13-24-17/h1-6,11,19H,7-10,12-13H2 |
| InChIKey | AGBLTJUXPJILJT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone?
The IUPAC name of 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone (CID 90630778) is 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone.
What is the SMILES notation for 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone?
The canonical SMILES for 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone is O=C(Cc1ccccc1F)N1CCSC(c2ccc3c(c2)OCO3)CC1.
What is the InChIKey of 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone?
The InChIKey is AGBLTJUXPJILJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FNO3S/c21-16-4-2-1-3-14(16)12-20(23)22-8-7-19(26-10-9-22)15-5-6-17-18(11-15)25-13-24-17/h1-6,11,19H,7-10,12-13H2.
What are the key properties of 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone?
1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone has a molecular weight of 373.45 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[7-(1,3-benzodioxol-5-yl)-1,4-thiazepan-4-yl]-2-(2-fluorophenyl)ethanone is sourced from PubChem (CID 90630778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).