C15H20F3NO2S2 — CID 90631545
7-(2-methylphenyl)-4-(3,3,3-trifluoropropylsulfonyl)-1,4-thiazepane (PubChem CID 90631545) has the molecular formula C15H20F3NO2S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 7-(2-methylphenyl)-4-(3,3,3-trifluoropropylsulfonyl)-1,4-thiazepane.
| Compound Name | 7-(2-methylphenyl)-4-(3,3,3-trifluoropropylsulfonyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90631545 |
| Molecular Formula | C15H20F3NO2S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 7-(2-methylphenyl)-4-(3,3,3-trifluoropropylsulfonyl)-1,4-thiazepane |
| SMILES | Cc1ccccc1C1CCN(S(=O)(=O)CCC(F)(F)F)CCS1 |
| InChI | InChI=1S/C15H20F3NO2S2/c1-12-4-2-3-5-13(12)14-6-8-19(9-10-22-14)23(20,21)11-7-15(16,17)18/h2-5,14H,6-11H2,1H3 |
| InChIKey | XNIIPBCJJQGEMY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |