C13H16N6O2 — CID 90633421
N-(4-pyrimidin-2-yloxycyclohexyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 90633421) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-(4-pyrimidin-2-yloxycyclohexyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(4-pyrimidin-2-yloxycyclohexyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 90633421 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-(4-pyrimidin-2-yloxycyclohexyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NC1CCC(Oc2ncccn2)CC1)c1ncn[nH]1 |
| InChI | InChI=1S/C13H16N6O2/c20-12(11-16-8-17-19-11)18-9-2-4-10(5-3-9)21-13-14-6-1-7-15-13/h1,6-10H,2-5H2,(H,18,20)(H,16,17,19) |
| InChIKey | LYWZOPQBYJDVDJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |