C17H18Cl2N4O2 — CID 90633471
1-(3,4-dichlorophenyl)-3-(4-pyrimidin-2-yloxycyclohexyl)urea (PubChem CID 90633471) has the molecular formula C17H18Cl2N4O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(4-pyrimidin-2-yloxycyclohexyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(4-pyrimidin-2-yloxycyclohexyl)urea |
|---|---|
| PubChem CID | 90633471 |
| Molecular Formula | C17H18Cl2N4O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(4-pyrimidin-2-yloxycyclohexyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NC1CCC(Oc2ncccn2)CC1 |
| InChI | InChI=1S/C17H18Cl2N4O2/c18-14-7-4-12(10-15(14)19)23-16(24)22-11-2-5-13(6-3-11)25-17-20-8-1-9-21-17/h1,4,7-11,13H,2-3,5-6H2,(H2,22,23,24) |
| InChIKey | DNZHKVWHKPBBEY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |