C16H18FN5O3 — CID 90634138
N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 90634138) has the molecular formula C16H18FN5O3 and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 90634138 |
| Molecular Formula | C16H18FN5O3 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NC2CCC(Oc3ncc(F)cn3)CC2)ccc1=O |
| InChI | InChI=1S/C16H18FN5O3/c1-22-14(23)7-6-13(21-22)15(24)20-11-2-4-12(5-3-11)25-16-18-8-10(17)9-19-16/h6-9,11-12H,2-5H2,1H3,(H,20,24) |
| InChIKey | HGWKKKSHMXNHDH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |