C19H22FN3O3S — CID 90634548
(E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-2-(4-methylphenyl)ethenesulfonamide (PubChem CID 90634548) has the molecular formula C19H22FN3O3S and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-2-(4-methylphenyl)ethenesulfonamide.
| Compound Name | (E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-2-(4-methylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 90634548 |
| Molecular Formula | C19H22FN3O3S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-2-(4-methylphenyl)ethenesulfonamide |
| SMILES | Cc1ccc(/C=C/S(=O)(=O)NC2CCC(Oc3ncc(F)cn3)CC2)cc1 |
| InChI | InChI=1S/C19H22FN3O3S/c1-14-2-4-15(5-3-14)10-11-27(24,25)23-17-6-8-18(9-7-17)26-19-21-12-16(20)13-22-19/h2-5,10-13,17-18,23H,6-9H2,1H3/b11-10+ |
| InChIKey | LZOJSYGFGRTDLP-ZHACJKMWSA-N |
| XLogP | 3.20 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |