About 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea
3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea (PubChem CID 90634997) has the molecular formula C17H28N4O2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea |
| PubChem CID | 90634997 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1CCC(Oc2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-5-21(6-2)17(22)20-14-7-9-15(10-8-14)23-16-18-12(3)11-13(4)19-16/h11,14-15H,5-10H2,1-4H3,(H,20,22) |
| InChIKey | ZGYRZJQKFOSUBU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea?
The IUPAC name of 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea (CID 90634997) is 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea.
What is the SMILES notation for 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea?
The canonical SMILES for 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea is CCN(CC)C(=O)NC1CCC(Oc2nc(C)cc(C)n2)CC1.
What is the InChIKey of 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea?
The InChIKey is ZGYRZJQKFOSUBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2/c1-5-21(6-2)17(22)20-14-7-9-15(10-8-14)23-16-18-12(3)11-13(4)19-16/h11,14-15H,5-10H2,1-4H3,(H,20,22).
What are the key properties of 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea?
3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea has a molecular weight of 320.44 g/mol, XLogP of 2.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]-1,1-diethylurea is sourced from PubChem (CID 90634997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).