About N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide
N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide (PubChem CID 90635022) has the molecular formula C16H27N3O3S
and a molecular weight of 341.48 g/mol. Its IUPAC name is N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide |
| PubChem CID | 90635022 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC1CCC(Oc2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C16H27N3O3S/c1-4-5-10-23(20,21)19-14-6-8-15(9-7-14)22-16-17-12(2)11-13(3)18-16/h11,14-15,19H,4-10H2,1-3H3 |
| InChIKey | CNXINLILTNPWJN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide?
The IUPAC name of N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide (CID 90635022) is N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide.
What is the SMILES notation for N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide?
The canonical SMILES for N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide is CCCCS(=O)(=O)NC1CCC(Oc2nc(C)cc(C)n2)CC1.
What is the InChIKey of N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide?
The InChIKey is CNXINLILTNPWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O3S/c1-4-5-10-23(20,21)19-14-6-8-15(9-7-14)22-16-17-12(2)11-13(3)18-16/h11,14-15,19H,4-10H2,1-3H3.
What are the key properties of N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide?
N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide has a molecular weight of 341.48 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4,6-dimethylpyrimidin-2-yl)oxycyclohexyl]butane-1-sulfonamide is sourced from PubChem (CID 90635022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).