About N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide
N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide (PubChem CID 90635489) has the molecular formula C20H20N2O3S
and a molecular weight of 368.46 g/mol. Its IUPAC name is N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide |
| PubChem CID | 90635489 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide |
| SMILES | Cc1ccc2cccc(S(=O)(=O)NCC3Cc4ccccc4CO3)c2n1 |
| InChI | InChI=1S/C20H20N2O3S/c1-14-9-10-15-7-4-8-19(20(15)22-14)26(23,24)21-12-18-11-16-5-2-3-6-17(16)13-25-18/h2-10,18,21H,11-13H2,1H3 |
| InChIKey | UHQATGCIWRKWNF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide?
The IUPAC name of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide (CID 90635489) is N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide.
What is the SMILES notation for N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide?
The canonical SMILES for N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide is Cc1ccc2cccc(S(=O)(=O)NCC3Cc4ccccc4CO3)c2n1.
What is the InChIKey of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide?
The InChIKey is UHQATGCIWRKWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3S/c1-14-9-10-15-7-4-8-19(20(15)22-14)26(23,24)21-12-18-11-16-5-2-3-6-17(16)13-25-18/h2-10,18,21H,11-13H2,1H3.
What are the key properties of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide?
N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide has a molecular weight of 368.46 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-2-methylquinoline-8-sulfonamide is sourced from PubChem (CID 90635489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).