About N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide
N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 90635847) has the molecular formula C20H20F3NO3
and a molecular weight of 379.38 g/mol. Its IUPAC name is N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide.
Molecular Properties
| Compound Name | N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide |
| PubChem CID | 90635847 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CN(CC1Cc2ccccc2CO1)C(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3NO3/c1-24(11-18-9-14-5-2-3-6-15(14)12-26-18)19(25)13-27-17-8-4-7-16(10-17)20(21,22)23/h2-8,10,18H,9,11-13H2,1H3 |
| InChIKey | HLKGAELXOPFAJV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide?
The IUPAC name of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide (CID 90635847) is N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide.
What is the SMILES notation for N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide?
The canonical SMILES for N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide is CN(CC1Cc2ccccc2CO1)C(=O)COc1cccc(C(F)(F)F)c1.
What is the InChIKey of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide?
The InChIKey is HLKGAELXOPFAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3NO3/c1-24(11-18-9-14-5-2-3-6-15(14)12-26-18)19(25)13-27-17-8-4-7-16(10-17)20(21,22)23/h2-8,10,18H,9,11-13H2,1H3.
What are the key properties of N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide?
N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide has a molecular weight of 379.38 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-1H-isochromen-3-ylmethyl)-N-methyl-2-[3-(trifluoromethyl)phenoxy]acetamide is sourced from PubChem (CID 90635847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).